C18H28N4O12 — CID 18747158
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid (PubChem CID 18747158) has the molecular formula C18H28N4O12 and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18747158 |
| Molecular Formula | C18H28N4O12 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H28N4O12/c1-7(23)14(19)17(32)20-8(2-4-11(24)25)15(30)22-10(6-13(28)29)16(31)21-9(18(33)34)3-5-12(26)27/h7-10,14,23H,2-6,19H2,1H3,(H,20,32)(H,21,31)(H,22,30)(H,24,25)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | JILFSQMRBPEWCA-UHFFFAOYSA-N |
| XLogP | -3.56 |
| TPSA | 282.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |