C15H28N4O7 — CID 18224280
6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18224280) has the molecular formula C15H28N4O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18224280 |
| Molecular Formula | C15H28N4O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C15H28N4O7/c1-8(20)12(17)14(24)18-9(5-6-11(21)22)13(23)19-10(15(25)26)4-2-3-7-16/h8-10,12,20H,2-7,16-17H2,1H3,(H,18,24)(H,19,23)(H,21,22)(H,25,26) |
| InChIKey | HJOSVGCWOTYJFG-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|