C13H24N2O7 — CID 142524099
2-formamidopentanedioic acid;2-(methylamino)hexanoic acid (PubChem CID 142524099) has the molecular formula C13H24N2O7 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-formamidopentanedioic acid;2-(methylamino)hexanoic acid.
| Compound Name | 2-formamidopentanedioic acid;2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 142524099 |
| Molecular Formula | C13H24N2O7 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-formamidopentanedioic acid;2-(methylamino)hexanoic acid |
| SMILES | CCCCC(NC)C(=O)O.O=CNC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H15NO2.C6H9NO5/c1-3-4-5-6(8-2)7(9)10;8-3-7-4(6(11)12)1-2-5(9)10/h6,8H,3-5H2,1-2H3,(H,9,10);3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OUMDJFQLYWSLCR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|