ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid

C15H30N2O7 — CID 142524077

IUPACethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid
SMILESCC.CCCCC(NC)C(=O)O.O=CNC(CCC(=O)O)C(=O)O
InChIInChI=1S/C7H15NO2.C6H9NO5.C2H6/c1-3-4-5-6(8-2)7(9)10;8-3-7-4(6(11)12)1-2-5(9)10;1-2/h6,8H,3-5H2,1-2H3,(H,9,10);3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H3
InChIKeyOFZXTSOOPAOZLD-UHFFFAOYSA-N
MW350.41 g/mol
LogP0.93
Rot. Bonds11

About ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid

ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid (PubChem CID 142524077) has the molecular formula C15H30N2O7 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid.

Molecular Properties

Compound Nameethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid
PubChem CID142524077
Molecular FormulaC15H30N2O7
Molecular Weight350.41 g/mol
Exact Mass350.21
IUPAC Nameethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid
SMILESCC.CCCCC(NC)C(=O)O.O=CNC(CCC(=O)O)C(=O)O
InChIInChI=1S/C7H15NO2.C6H9NO5.C2H6/c1-3-4-5-6(8-2)7(9)10;8-3-7-4(6(11)12)1-2-5(9)10;1-2/h6,8H,3-5H2,1-2H3,(H,9,10);3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H3
InChIKeyOFZXTSOOPAOZLD-UHFFFAOYSA-N
XLogP0.93
TPSA153.03 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.41
LogP ≤ 50.93
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid?
The IUPAC name of ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid (CID 142524077) is ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid.
What is the SMILES notation for ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid?
The canonical SMILES for ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid is CC.CCCCC(NC)C(=O)O.O=CNC(CCC(=O)O)C(=O)O.
What is the InChIKey of ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid?
The InChIKey is OFZXTSOOPAOZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H9NO5.C2H6/c1-3-4-5-6(8-2)7(9)10;8-3-7-4(6(11)12)1-2-5(9)10;1-2/h6,8H,3-5H2,1-2H3,(H,9,10);3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H3.
What are the key properties of ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid?
ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid has a molecular weight of 350.41 g/mol, XLogP of 0.93, 11 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid is sourced from PubChem (CID 142524077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).