C15H30N2O7 — CID 142524077
ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid (PubChem CID 142524077) has the molecular formula C15H30N2O7 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid.
| Compound Name | ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 142524077 |
| Molecular Formula | C15H30N2O7 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethane;2-formamidopentanedioic acid;2-(methylamino)hexanoic acid |
| SMILES | CC.CCCCC(NC)C(=O)O.O=CNC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H15NO2.C6H9NO5.C2H6/c1-3-4-5-6(8-2)7(9)10;8-3-7-4(6(11)12)1-2-5(9)10;1-2/h6,8H,3-5H2,1-2H3,(H,9,10);3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H3 |
| InChIKey | OFZXTSOOPAOZLD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|