C14H25N5O7 — CID 172602566
4-[[4-carboxy-2-(2-methylhydrazinyl)butanoyl]amino]-5-(2-formamidoethylamino)-5-oxopentanoic acid (PubChem CID 172602566) has the molecular formula C14H25N5O7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-[[4-carboxy-2-(2-methylhydrazinyl)butanoyl]amino]-5-(2-formamidoethylamino)-5-oxopentanoic acid.
| Compound Name | 4-[[4-carboxy-2-(2-methylhydrazinyl)butanoyl]amino]-5-(2-formamidoethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 172602566 |
| Molecular Formula | C14H25N5O7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[[4-carboxy-2-(2-methylhydrazinyl)butanoyl]amino]-5-(2-formamidoethylamino)-5-oxopentanoic acid |
| SMILES | CNNC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NCCNC=O |
| InChI | InChI=1S/C14H25N5O7/c1-15-19-10(3-5-12(23)24)14(26)18-9(2-4-11(21)22)13(25)17-7-6-16-8-20/h8-10,15,19H,2-7H2,1H3,(H,16,20)(H,17,25)(H,18,26)(H,21,22)(H,23,24) |
| InChIKey | VDEFNRFMSJIOTF-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|