C19H30N6O10 — CID 77068220
(4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(2S)-1-[[2-[[(2S)-3-carboxy-1-oxo-1-(2-oxoethylamino)propan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 77068220) has the molecular formula C19H30N6O10 and a molecular weight of 502.48 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(2S)-1-[[2-[[(2S)-3-carboxy-1-oxo-1-(2-oxoethylamino)propan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(2S)-1-[[2-[[(2S)-3-carboxy-1-oxo-1-(2-oxoethylamino)propan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 77068220 |
| Molecular Formula | C19H30N6O10 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(2S)-1-[[2-[[(2S)-3-carboxy-1-oxo-1-(2-oxoethylamino)propan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)NCC=O |
| InChI | InChI=1S/C19H30N6O10/c1-9(20)16(32)25-11(3-4-14(28)29)19(35)23-10(2)17(33)22-8-13(27)24-12(7-15(30)31)18(34)21-5-6-26/h6,9-12H,3-5,7-8,20H2,1-2H3,(H,21,34)(H,22,33)(H,23,35)(H,24,27)(H,25,32)(H,28,29)(H,30,31)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | JVVWEMJTWMEAGT-BJDJZHNGSA-N |
| XLogP | -4.42 |
| TPSA | 263.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|