C25H40N6O14 — CID 21255821
2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-4-carboxybutanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 21255821) has the molecular formula C25H40N6O14 and a molecular weight of 648.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-4-carboxybutanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-4-carboxybutanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 21255821 |
| Molecular Formula | C25H40N6O14 |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 2-[[2-[[2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-4-carboxybutanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(N)CO)C(=O)O |
| InChI | InChI=1S/C25H40N6O14/c1-11(2)7-16(25(44)45)31-23(42)14(4-6-19(36)37)30-24(43)15(8-20(38)39)28-17(33)9-27-22(41)13(3-5-18(34)35)29-21(40)12(26)10-32/h11-16,32H,3-10,26H2,1-2H3,(H,27,41)(H,28,33)(H,29,40)(H,30,43)(H,31,42)(H,34,35)(H,36,37)(H,38,39)(H,44,45) |
| InChIKey | CLOMLWOCIDPIEH-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 340.95 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |