C29H44N6O17 — CID 19018448
2-[[2-[[2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 19018448) has the molecular formula C29H44N6O17 and a molecular weight of 748.70 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 19018448 |
| Molecular Formula | C29H44N6O17 |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 748.28 |
| IUPAC Name | 2-[[2-[[2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H44N6O17/c1-12(2)9-18(29(51)52)35-26(48)15(5-8-21(40)41)32-28(50)17(11-23(44)45)34-25(47)14(4-7-20(38)39)31-27(49)16(10-22(42)43)33-24(46)13(30)3-6-19(36)37/h12-18H,3-11,30H2,1-2H3,(H,31,49)(H,32,50)(H,33,46)(H,34,47)(H,35,48)(H,36,37)(H,38,39)(H,40,41)(H,42,43)(H,44,45)(H,51,52) |
| InChIKey | XKDHUDZZHLIFGP-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 395.32 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |