C21H34N4O11 — CID 175899248
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid (PubChem CID 175899248) has the molecular formula C21H34N4O11 and a molecular weight of 518.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175899248 |
| Molecular Formula | C21H34N4O11 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H34N4O11/c1-10(2)9-14(20(34)24-13(21(35)36)5-8-17(30)31)25-19(33)12(4-7-16(28)29)23-18(32)11(22)3-6-15(26)27/h10-14H,3-9,22H2,1-2H3,(H,23,32)(H,24,34)(H,25,33)(H,26,27)(H,28,29)(H,30,31)(H,35,36)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | WGFKJLAJMZQTGR-XUXIUFHCSA-N |
| XLogP | -1.51 |
| TPSA | 262.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |