C16H28N4O7 — CID 174184455
5-(2-acetamidoethylamino)-4-[[5-methoxy-2-(methylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 174184455) has the molecular formula C16H28N4O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 5-(2-acetamidoethylamino)-4-[[5-methoxy-2-(methylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-(2-acetamidoethylamino)-4-[[5-methoxy-2-(methylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174184455 |
| Molecular Formula | C16H28N4O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-(2-acetamidoethylamino)-4-[[5-methoxy-2-(methylamino)-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CNC(CCC(=O)OC)C(=O)NC(CCC(=O)O)C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C16H28N4O7/c1-10(21)18-8-9-19-15(25)12(4-6-13(22)23)20-16(26)11(17-2)5-7-14(24)27-3/h11-12,17H,4-9H2,1-3H3,(H,18,21)(H,19,25)(H,20,26)(H,22,23) |
| InChIKey | VZXVQFBHSCORMM-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|