C18H38N2O5S — CID 154660462
ethane;methyl (4S)-4-(methylamino)-5-oxo-5-(2-oxopropylamino)pentanoate;S-methyl propanethioate (PubChem CID 154660462) has the molecular formula C18H38N2O5S and a molecular weight of 394.58 g/mol. Its IUPAC name is ethane;methyl (4S)-4-(methylamino)-5-oxo-5-(2-oxopropylamino)pentanoate;S-methyl propanethioate.
| Compound Name | ethane;methyl (4S)-4-(methylamino)-5-oxo-5-(2-oxopropylamino)pentanoate;S-methyl propanethioate |
|---|---|
| PubChem CID | 154660462 |
| Molecular Formula | C18H38N2O5S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethane;methyl (4S)-4-(methylamino)-5-oxo-5-(2-oxopropylamino)pentanoate;S-methyl propanethioate |
| SMILES | CC.CC.CCC(=O)SC.CN[C@@H](CCC(=O)OC)C(=O)NCC(C)=O |
| InChI | InChI=1S/C10H18N2O4.C4H8OS.2C2H6/c1-7(13)6-12-10(15)8(11-2)4-5-9(14)16-3;1-3-4(5)6-2;2*1-2/h8,11H,4-6H2,1-3H3,(H,12,15);3H2,1-2H3;2*1-2H3/t8-;;;/m0.../s1 |
| InChIKey | JVPOMSQSXFSARE-CZDIJEQGSA-N |
| XLogP | 2.57 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|