C11H23NO3 — CID 145216603
methyl (4S)-4-methyl-5-(methylamino)-5-oxopentanoate;propane (PubChem CID 145216603) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is methyl (4S)-4-methyl-5-(methylamino)-5-oxopentanoate;propane.
| Compound Name | methyl (4S)-4-methyl-5-(methylamino)-5-oxopentanoate;propane |
|---|---|
| PubChem CID | 145216603 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | methyl (4S)-4-methyl-5-(methylamino)-5-oxopentanoate;propane |
| SMILES | CCC.CNC(=O)[C@@H](C)CCC(=O)OC |
| InChI | InChI=1S/C8H15NO3.C3H8/c1-6(8(11)9-2)4-5-7(10)12-3;1-3-2/h6H,4-5H2,1-3H3,(H,9,11);3H2,1-2H3/t6-;/m0./s1 |
| InChIKey | RKXZCCVKEDHNHC-RGMNGODLSA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |