C9H20N2O2 — CID 145111022
N,2-dimethylpentanediamide;ethane (PubChem CID 145111022) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N,2-dimethylpentanediamide;ethane.
| Compound Name | N,2-dimethylpentanediamide;ethane |
|---|---|
| PubChem CID | 145111022 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N,2-dimethylpentanediamide;ethane |
| SMILES | CC.CNC(=O)C(C)CCC(N)=O |
| InChI | InChI=1S/C7H14N2O2.C2H6/c1-5(7(11)9-2)3-4-6(8)10;1-2/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11);1-2H3 |
| InChIKey | YAQFJMPDUUHVGC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |