C7H14N2O2 — CID 21268064
N',2-dimethylpentanediamide (PubChem CID 21268064) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N',2-dimethylpentanediamide.
| Compound Name | N',2-dimethylpentanediamide |
|---|---|
| PubChem CID | 21268064 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N',2-dimethylpentanediamide |
| SMILES | CNC(=O)CCC(C)C(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-5(7(8)11)3-4-6(10)9-2/h5H,3-4H2,1-2H3,(H2,8,11)(H,9,10) |
| InChIKey | FPIYJLXJPSEFET-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |