About 2-methylpentanediamide
2-methylpentanediamide (PubChem CID 19688970) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-methylpentanediamide.
Molecular Properties
| Compound Name | 2-methylpentanediamide |
| PubChem CID | 19688970 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-methylpentanediamide |
| SMILES | CC(CCC(N)=O)C(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-4(6(8)10)2-3-5(7)9/h4H,2-3H2,1H3,(H2,7,9)(H2,8,10) |
| InChIKey | MFXUHBWEUJSJAU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentanediamide?
The IUPAC name of 2-methylpentanediamide (CID 19688970) is 2-methylpentanediamide.
What is the SMILES notation for 2-methylpentanediamide?
The canonical SMILES for 2-methylpentanediamide is CC(CCC(N)=O)C(N)=O.
What is the InChIKey of 2-methylpentanediamide?
The InChIKey is MFXUHBWEUJSJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-4(6(8)10)2-3-5(7)9/h4H,2-3H2,1H3,(H2,7,9)(H2,8,10).
What are the key properties of 2-methylpentanediamide?
2-methylpentanediamide has a molecular weight of 144.17 g/mol, XLogP of -0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentanediamide is sourced from PubChem (CID 19688970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).