About 2-hydroxypentanediamide
2-hydroxypentanediamide (PubChem CID 559184) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-hydroxypentanediamide.
Molecular Properties
| Compound Name | 2-hydroxypentanediamide |
| PubChem CID | 559184 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2-hydroxypentanediamide |
| SMILES | NC(=O)CCC(O)C(N)=O |
| InChI | InChI=1S/C5H10N2O3/c6-4(9)2-1-3(8)5(7)10/h3,8H,1-2H2,(H2,6,9)(H2,7,10) |
| InChIKey | YXFZJXLQGULFAG-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxypentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypentanediamide?
The IUPAC name of 2-hydroxypentanediamide (CID 559184) is 2-hydroxypentanediamide.
What is the SMILES notation for 2-hydroxypentanediamide?
The canonical SMILES for 2-hydroxypentanediamide is NC(=O)CCC(O)C(N)=O.
What is the InChIKey of 2-hydroxypentanediamide?
The InChIKey is YXFZJXLQGULFAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c6-4(9)2-1-3(8)5(7)10/h3,8H,1-2H2,(H2,6,9)(H2,7,10).
What are the key properties of 2-hydroxypentanediamide?
2-hydroxypentanediamide has a molecular weight of 146.15 g/mol, XLogP of -1.90, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypentanediamide is sourced from PubChem (CID 559184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).