C9H19NO — CID 78065622
N,2,5-trimethylhexanamide (PubChem CID 78065622) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is N,2,5-trimethylhexanamide.
| Compound Name | N,2,5-trimethylhexanamide |
|---|---|
| PubChem CID | 78065622 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N,2,5-trimethylhexanamide |
| SMILES | CNC(=O)C(C)CCC(C)C |
| InChI | InChI=1S/C9H19NO/c1-7(2)5-6-8(3)9(11)10-4/h7-8H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | QBQMWBLVYOKZOW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |