C5H11NOS — CID 13075016
N,2-dimethyl-3-sulfanylpropanamide (PubChem CID 13075016) has the molecular formula C5H11NOS and a molecular weight of 133.22 g/mol. Its IUPAC name is N,2-dimethyl-3-sulfanylpropanamide.
| Compound Name | N,2-dimethyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 13075016 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | N,2-dimethyl-3-sulfanylpropanamide |
| SMILES | CNC(=O)C(C)CS |
| InChI | InChI=1S/C5H11NOS/c1-4(3-8)5(7)6-2/h4,8H,3H2,1-2H3,(H,6,7) |
| InChIKey | ZHMCAKDNKHCALC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|