C8H16FN3O2S2 — CID 139308462
(2R)-2-fluoro-2-(methylamino)-N-[(2S)-1-(methylamino)-1-oxo-3-sulfanylpropan-2-yl]-3-sulfanylpropanamide (PubChem CID 139308462) has the molecular formula C8H16FN3O2S2 and a molecular weight of 269.37 g/mol. Its IUPAC name is (2R)-2-fluoro-2-(methylamino)-N-[(2S)-1-(methylamino)-1-oxo-3-sulfanylpropan-2-yl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-fluoro-2-(methylamino)-N-[(2S)-1-(methylamino)-1-oxo-3-sulfanylpropan-2-yl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 139308462 |
| Molecular Formula | C8H16FN3O2S2 |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (2R)-2-fluoro-2-(methylamino)-N-[(2S)-1-(methylamino)-1-oxo-3-sulfanylpropan-2-yl]-3-sulfanylpropanamide |
| SMILES | CNC(=O)[C@@H](CS)NC(=O)[C@@](F)(CS)NC |
| InChI | InChI=1S/C8H16FN3O2S2/c1-10-6(13)5(3-15)12-7(14)8(9,4-16)11-2/h5,11,15-16H,3-4H2,1-2H3,(H,10,13)(H,12,14)/t5-,8-/m1/s1 |
| InChIKey | IOCFLBZPHLZNSY-SVGQVSJJSA-N |
| XLogP | -1.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|