C9H17N3O3S — CID 107769385
2-acetamido-N-[3-(methylamino)-3-oxopropyl]-3-sulfanylpropanamide (PubChem CID 107769385) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-acetamido-N-[3-(methylamino)-3-oxopropyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[3-(methylamino)-3-oxopropyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769385 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-acetamido-N-[3-(methylamino)-3-oxopropyl]-3-sulfanylpropanamide |
| SMILES | CNC(=O)CCNC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C9H17N3O3S/c1-6(13)12-7(5-16)9(15)11-4-3-8(14)10-2/h7,16H,3-5H2,1-2H3,(H,10,14)(H,11,15)(H,12,13) |
| InChIKey | ZAZFZIBNHBBNTM-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|