C8H17N3O4S2 — CID 114175652
2-acetamido-N-[2-(methylsulfamoyl)ethyl]-3-sulfanylpropanamide (PubChem CID 114175652) has the molecular formula C8H17N3O4S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-acetamido-N-[2-(methylsulfamoyl)ethyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-(methylsulfamoyl)ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 114175652 |
| Molecular Formula | C8H17N3O4S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-acetamido-N-[2-(methylsulfamoyl)ethyl]-3-sulfanylpropanamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C8H17N3O4S2/c1-6(12)11-7(5-16)8(13)10-3-4-17(14,15)9-2/h7,9,16H,3-5H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | SQACMFQPAKZRDM-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|