C11H21N3O4S — CID 107769839
2-acetamido-N-[3-(2-methoxyethylamino)-3-oxopropyl]-3-sulfanylpropanamide (PubChem CID 107769839) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-acetamido-N-[3-(2-methoxyethylamino)-3-oxopropyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[3-(2-methoxyethylamino)-3-oxopropyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769839 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-acetamido-N-[3-(2-methoxyethylamino)-3-oxopropyl]-3-sulfanylpropanamide |
| SMILES | COCCNC(=O)CCNC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C11H21N3O4S/c1-8(15)14-9(7-19)11(17)13-4-3-10(16)12-5-6-18-2/h9,19H,3-7H2,1-2H3,(H,12,16)(H,13,17)(H,14,15) |
| InChIKey | ITZBSEQZSFZQLE-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|