C10H19N3O4S — CID 107769824
2-acetamido-N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-sulfanylpropanamide (PubChem CID 107769824) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-acetamido-N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769824 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-acetamido-N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-sulfanylpropanamide |
| SMILES | COCCNC(=O)CNC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C10H19N3O4S/c1-7(14)13-8(6-18)10(16)12-5-9(15)11-3-4-17-2/h8,18H,3-6H2,1-2H3,(H,11,15)(H,12,16)(H,13,14) |
| InChIKey | IFRRLBTVPCNTHU-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|