About 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate
3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 107775731) has the molecular formula C9H17NO4S
and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate |
| PubChem CID | 107775731 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | COCCCOC(=O)[C@H](CS)NC(C)=O |
| InChI | InChI=1S/C9H17NO4S/c1-7(11)10-8(6-15)9(12)14-5-3-4-13-2/h8,15H,3-6H2,1-2H3,(H,10,11)/t8-/m0/s1 |
| InChIKey | PUSAFCJAKLETGD-QMMMGPOBSA-N |
| XLogP | 0.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate?
The IUPAC name of 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate (CID 107775731) is 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate.
What is the SMILES notation for 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate?
The canonical SMILES for 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate is COCCCOC(=O)[C@H](CS)NC(C)=O.
What is the InChIKey of 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate?
The InChIKey is PUSAFCJAKLETGD-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-7(11)10-8(6-15)9(12)14-5-3-4-13-2/h8,15H,3-6H2,1-2H3,(H,10,11)/t8-/m0/s1.
What are the key properties of 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate?
3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate has a molecular weight of 235.30 g/mol, XLogP of 0.00, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl (2R)-2-acetamido-3-sulfanylpropanoate is sourced from PubChem (CID 107775731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).