C10H21NO6SSi — CID 90763900
2-trimethoxysilylethyl (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 90763900) has the molecular formula C10H21NO6SSi and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-trimethoxysilylethyl (2R)-2-acetamido-3-sulfanylpropanoate.
| Compound Name | 2-trimethoxysilylethyl (2R)-2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 90763900 |
| Molecular Formula | C10H21NO6SSi |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-trimethoxysilylethyl (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CO[Si](CCOC(=O)[C@H](CS)NC(C)=O)(OC)OC |
| InChI | InChI=1S/C10H21NO6SSi/c1-8(12)11-9(7-18)10(13)17-5-6-19(14-2,15-3)16-4/h9,18H,5-7H2,1-4H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | MUFKCUHFFDPRSI-VIFPVBQESA-N |
| XLogP | -0.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|