C8H15NO4S — CID 163263817
1-methoxyethyl 2-acetamido-3-sulfanylpropanoate (PubChem CID 163263817) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-methoxyethyl 2-acetamido-3-sulfanylpropanoate.
| Compound Name | 1-methoxyethyl 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 163263817 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-methoxyethyl 2-acetamido-3-sulfanylpropanoate |
| SMILES | COC(C)OC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C8H15NO4S/c1-5(10)9-7(4-14)8(11)13-6(2)12-3/h6-7,14H,4H2,1-3H3,(H,9,10) |
| InChIKey | WIXFSSZIBNXXDB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|