C5H10NO6PS — CID 174794076
phosphono (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 174794076) has the molecular formula C5H10NO6PS and a molecular weight of 243.18 g/mol. Its IUPAC name is phosphono (2R)-2-acetamido-3-sulfanylpropanoate.
| Compound Name | phosphono (2R)-2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 174794076 |
| Molecular Formula | C5H10NO6PS |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | phosphono (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C5H10NO6PS/c1-3(7)6-4(2-14)5(8)12-13(9,10)11/h4,14H,2H2,1H3,(H,6,7)(H2,9,10,11)/t4-/m0/s1 |
| InChIKey | ITWHCCNBYBPGAU-BYPYZUCNSA-N |
| XLogP | -0.94 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|