C8H13NO6S — CID 138986918
2-hydroxypropanoyl 2-acetamido-3-sulfanylpropaneperoxoate (PubChem CID 138986918) has the molecular formula C8H13NO6S and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-hydroxypropanoyl 2-acetamido-3-sulfanylpropaneperoxoate.
| Compound Name | 2-hydroxypropanoyl 2-acetamido-3-sulfanylpropaneperoxoate |
|---|---|
| PubChem CID | 138986918 |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-hydroxypropanoyl 2-acetamido-3-sulfanylpropaneperoxoate |
| SMILES | CC(=O)NC(CS)C(=O)OOC(=O)C(C)O |
| InChI | InChI=1S/C8H13NO6S/c1-4(10)7(12)14-15-8(13)6(3-16)9-5(2)11/h4,6,10,16H,3H2,1-2H3,(H,9,11) |
| InChIKey | CFECEKWODCPWRG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|