C9H17N3O6 — CID 113405676
(2S)-3-hydroxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid (PubChem CID 113405676) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 113405676 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2S)-3-hydroxy-2-[[2-(2-methoxyethylamino)-2-oxoethyl]carbamoylamino]propanoic acid |
| SMILES | COCCNC(=O)CNC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H17N3O6/c1-18-3-2-10-7(14)4-11-9(17)12-6(5-13)8(15)16/h6,13H,2-5H2,1H3,(H,10,14)(H,15,16)(H2,11,12,17)/t6-/m0/s1 |
| InChIKey | JDMMYCRIYPUNGP-LURJTMIESA-N |
| XLogP | -2.51 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|