C9H17N3O4 — CID 64581277
2-acetamido-3-[[3-(methylamino)-3-oxopropyl]amino]propanoic acid (PubChem CID 64581277) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-acetamido-3-[[3-(methylamino)-3-oxopropyl]amino]propanoic acid.
| Compound Name | 2-acetamido-3-[[3-(methylamino)-3-oxopropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 64581277 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-acetamido-3-[[3-(methylamino)-3-oxopropyl]amino]propanoic acid |
| SMILES | CNC(=O)CCNCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-6(13)12-7(9(15)16)5-11-4-3-8(14)10-2/h7,11H,3-5H2,1-2H3,(H,10,14)(H,12,13)(H,15,16) |
| InChIKey | VDLXRGSKYLANOC-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|