2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid

C10H20N2O3 — CID 64583872

IUPAC2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid
SMILESCC(=O)NC(CNCC(C)(C)C)C(=O)O
InChIInChI=1S/C10H20N2O3/c1-7(13)12-8(9(14)15)5-11-6-10(2,3)4/h8,11H,5-6H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyDVWRFKFZWZHNCM-UHFFFAOYSA-N
MW216.28 g/mol
LogP0.21
Rot. Bonds5

About 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid

2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid (PubChem CID 64583872) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid
PubChem CID64583872
Molecular FormulaC10H20N2O3
Molecular Weight216.28 g/mol
Exact Mass216.15
IUPAC Name2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid
SMILESCC(=O)NC(CNCC(C)(C)C)C(=O)O
InChIInChI=1S/C10H20N2O3/c1-7(13)12-8(9(14)15)5-11-6-10(2,3)4/h8,11H,5-6H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyDVWRFKFZWZHNCM-UHFFFAOYSA-N
XLogP0.21
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 50.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid?
The IUPAC name of 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid (CID 64583872) is 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid?
The canonical SMILES for 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid is CC(=O)NC(CNCC(C)(C)C)C(=O)O.
What is the InChIKey of 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid?
The InChIKey is DVWRFKFZWZHNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-7(13)12-8(9(14)15)5-11-6-10(2,3)4/h8,11H,5-6H2,1-4H3,(H,12,13)(H,14,15).
What are the key properties of 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid?
2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid has a molecular weight of 216.28 g/mol, XLogP of 0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(2,2-dimethylpropylamino)propanoic acid is sourced from PubChem (CID 64583872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).