About 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid
2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid (PubChem CID 64582721) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid.
Analyze 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid?
The IUPAC name of 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid (CID 64582721) is 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid.
What is the SMILES notation for 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid?
The canonical SMILES for 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid is CC(=O)NC(CN(C)CC(C)(C)C)C(=O)O.
What is the InChIKey of 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid?
The InChIKey is QIPSSPJPKCDEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-8(14)12-9(10(15)16)6-13(5)7-11(2,3)4/h9H,6-7H2,1-5H3,(H,12,14)(H,15,16).
What are the key properties of 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid?
2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid has a molecular weight of 230.31 g/mol, XLogP of 0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-[2,2-dimethylpropyl(methyl)amino]propanoic acid is sourced from PubChem (CID 64582721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).