C11H20N2O3 — CID 64583130
2-acetamido-3-[methyl-[(2-methylcyclopropyl)methyl]amino]propanoic acid (PubChem CID 64583130) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-acetamido-3-[methyl-[(2-methylcyclopropyl)methyl]amino]propanoic acid.
| Compound Name | 2-acetamido-3-[methyl-[(2-methylcyclopropyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 64583130 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-acetamido-3-[methyl-[(2-methylcyclopropyl)methyl]amino]propanoic acid |
| SMILES | CC(=O)NC(CN(C)CC1CC1C)C(=O)O |
| InChI | InChI=1S/C11H20N2O3/c1-7-4-9(7)5-13(3)6-10(11(15)16)12-8(2)14/h7,9-10H,4-6H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | LASMKBSQDJGNNA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |