C9H15F3N2O3 — CID 115518169
2-acetamido-3-(4,4,4-trifluorobutylamino)propanoic acid (PubChem CID 115518169) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-acetamido-3-(4,4,4-trifluorobutylamino)propanoic acid.
| Compound Name | 2-acetamido-3-(4,4,4-trifluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 115518169 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-acetamido-3-(4,4,4-trifluorobutylamino)propanoic acid |
| SMILES | CC(=O)NC(CNCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3N2O3/c1-6(15)14-7(8(16)17)5-13-4-2-3-9(10,11)12/h7,13H,2-5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | XQOXFSKCLVLOEH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|