C7H11F6NO — CID 115518334
1,1,1-trifluoro-3-(4,4,4-trifluorobutylamino)propan-2-ol (PubChem CID 115518334) has the molecular formula C7H11F6NO and a molecular weight of 239.16 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4,4,4-trifluorobutylamino)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(4,4,4-trifluorobutylamino)propan-2-ol |
|---|---|
| PubChem CID | 115518334 |
| Molecular Formula | C7H11F6NO |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1,1,1-trifluoro-3-(4,4,4-trifluorobutylamino)propan-2-ol |
| SMILES | OC(CNCCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F6NO/c8-6(9,10)2-1-3-14-4-5(15)7(11,12)13/h5,14-15H,1-4H2 |
| InChIKey | RIJCKFQUJUUDHE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|