C13H18F3NO3S — CID 115518341
1-(4-methylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)ethanol (PubChem CID 115518341) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)ethanol.
| Compound Name | 1-(4-methylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)ethanol |
|---|---|
| PubChem CID | 115518341 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)ethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CNCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-21(19,20)11-5-3-10(4-6-11)12(18)9-17-8-2-7-13(14,15)16/h3-6,12,17-18H,2,7-9H2,1H3 |
| InChIKey | HFWPAYRLYWILMY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|