C15H19NO3S2 — CID 93384250
(1R)-1-(4-methylsulfonylphenyl)-2-(2-thiophen-2-ylethylamino)ethanol (PubChem CID 93384250) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (1R)-1-(4-methylsulfonylphenyl)-2-(2-thiophen-2-ylethylamino)ethanol.
| Compound Name | (1R)-1-(4-methylsulfonylphenyl)-2-(2-thiophen-2-ylethylamino)ethanol |
|---|---|
| PubChem CID | 93384250 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (1R)-1-(4-methylsulfonylphenyl)-2-(2-thiophen-2-ylethylamino)ethanol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](O)CNCCc2cccs2)cc1 |
| InChI | InChI=1S/C15H19NO3S2/c1-21(18,19)14-6-4-12(5-7-14)15(17)11-16-9-8-13-3-2-10-20-13/h2-7,10,15-17H,8-9,11H2,1H3/t15-/m0/s1 |
| InChIKey | QATTYDQPUNLLFL-HNNXBMFYSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|