C10H17NOS — CID 13476299
1-(2-thiophen-2-ylethylamino)butan-2-ol (PubChem CID 13476299) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethylamino)butan-2-ol.
| Compound Name | 1-(2-thiophen-2-ylethylamino)butan-2-ol |
|---|---|
| PubChem CID | 13476299 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(2-thiophen-2-ylethylamino)butan-2-ol |
| SMILES | CCC(O)CNCCc1cccs1 |
| InChI | InChI=1S/C10H17NOS/c1-2-9(12)8-11-6-5-10-4-3-7-13-10/h3-4,7,9,11-12H,2,5-6,8H2,1H3 |
| InChIKey | JGJDNCGFBCCRMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|