C17H31NO2S — CID 60899325
1-(2-ethylhexoxy)-3-(2-thiophen-2-ylethylamino)propan-2-ol (PubChem CID 60899325) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is 1-(2-ethylhexoxy)-3-(2-thiophen-2-ylethylamino)propan-2-ol.
| Compound Name | 1-(2-ethylhexoxy)-3-(2-thiophen-2-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60899325 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 1-(2-ethylhexoxy)-3-(2-thiophen-2-ylethylamino)propan-2-ol |
| SMILES | CCCCC(CC)COCC(O)CNCCc1cccs1 |
| InChI | InChI=1S/C17H31NO2S/c1-3-5-7-15(4-2)13-20-14-16(19)12-18-10-9-17-8-6-11-21-17/h6,8,11,15-16,18-19H,3-5,7,9-10,12-14H2,1-2H3 |
| InChIKey | XGSIAYUFJHVVNS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|