C17H23N3O2S2 — CID 111614585
2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111614585) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111614585 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCc1ccc(S(C)(=O)=O)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-18-17(20-12-10-15-4-3-13-23-15)19-11-9-14-5-7-16(8-6-14)24(2,21)22/h3-8,13H,9-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | OYFQVLARMVHDQQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|