C17H22ClN3O2S2 — CID 111613688
1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine (PubChem CID 111613688) has the molecular formula C17H22ClN3O2S2 and a molecular weight of 399.97 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111613688 |
| Molecular Formula | C17H22ClN3O2S2 |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(S(C)(=O)=O)cc1)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H22ClN3O2S2/c1-19-17(21-12-10-14-5-8-16(18)24-14)20-11-9-13-3-6-15(7-4-13)25(2,22)23/h3-8H,9-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | NCTVQSSTIAXJLT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|