C18H24ClN3O2S — CID 111214127
1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111214127) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111214127 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C18H24ClN3O2S/c1-20-18(22-11-9-14-5-7-17(19)25-14)21-10-8-13-4-6-15(23-2)16(12-13)24-3/h4-7,12H,8-11H2,1-3H3,(H2,20,21,22) |
| InChIKey | YBKUWNFMTWAJEA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|