C20H25ClFN3O2 — CID 111578027
1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111578027) has the molecular formula C20H25ClFN3O2 and a molecular weight of 393.89 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111578027 |
| Molecular Formula | C20H25ClFN3O2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H25ClFN3O2/c1-23-20(25-11-9-15-5-6-16(22)13-17(15)21)24-10-8-14-4-7-18(26-2)19(12-14)27-3/h4-7,12-13H,8-11H2,1-3H3,(H2,23,24,25) |
| InChIKey | BMMVIFVKCFZBHC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|