C16H26N4O3S — CID 111614337
2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]-N-propylacetamide (PubChem CID 111614337) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]-N-propylacetamide.
| Compound Name | 2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111614337 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN/C(=N\C)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H26N4O3S/c1-4-10-18-15(21)12-20-16(17-2)19-11-9-13-5-7-14(8-6-13)24(3,22)23/h5-8H,4,9-12H2,1-3H3,(H,18,21)(H2,17,19,20) |
| InChIKey | ALAQIBPLVBUNRG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|