C21H35IN4O3S — CID 111614545
2-cyclohexyl-N-[2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111614545) has the molecular formula C21H35IN4O3S and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111614545 |
| Molecular Formula | C21H35IN4O3S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[N'-methyl-N-[2-(4-methylsulfonylphenyl)ethyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)CC1CCCCC1)NCCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C21H34N4O3S.HI/c1-22-21(24-13-12-17-8-10-19(11-9-17)29(2,27)28)25-15-14-23-20(26)16-18-6-4-3-5-7-18;/h8-11,18H,3-7,12-16H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | MIQXGCZURKGCFK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|