C14H20F3NO — CID 63227305
1-(4-propan-2-ylphenyl)-2-(3,3,3-trifluoropropylamino)ethanol (PubChem CID 63227305) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-2-(3,3,3-trifluoropropylamino)ethanol.
| Compound Name | 1-(4-propan-2-ylphenyl)-2-(3,3,3-trifluoropropylamino)ethanol |
|---|---|
| PubChem CID | 63227305 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-2-(3,3,3-trifluoropropylamino)ethanol |
| SMILES | CC(C)c1ccc(C(O)CNCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3NO/c1-10(2)11-3-5-12(6-4-11)13(19)9-18-8-7-14(15,16)17/h3-6,10,13,18-19H,7-9H2,1-2H3 |
| InChIKey | WNTLDWWUCBVOKV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|