C17H29NO — CID 64569516
2-(2,3-dimethylbutylamino)-1-(4-propan-2-ylphenyl)ethanol (PubChem CID 64569516) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-(2,3-dimethylbutylamino)-1-(4-propan-2-ylphenyl)ethanol.
| Compound Name | 2-(2,3-dimethylbutylamino)-1-(4-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 64569516 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-(2,3-dimethylbutylamino)-1-(4-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1ccc(C(O)CNCC(C)C(C)C)cc1 |
| InChI | InChI=1S/C17H29NO/c1-12(2)14(5)10-18-11-17(19)16-8-6-15(7-9-16)13(3)4/h6-9,12-14,17-19H,10-11H2,1-5H3 |
| InChIKey | VSLFSMZYGLMEIH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |