C11H20F3NO2 — CID 115518339
1-(cyclopropylmethoxy)-3-(4,4,4-trifluorobutylamino)propan-2-ol (PubChem CID 115518339) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-(cyclopropylmethoxy)-3-(4,4,4-trifluorobutylamino)propan-2-ol.
| Compound Name | 1-(cyclopropylmethoxy)-3-(4,4,4-trifluorobutylamino)propan-2-ol |
|---|---|
| PubChem CID | 115518339 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-(cyclopropylmethoxy)-3-(4,4,4-trifluorobutylamino)propan-2-ol |
| SMILES | OC(CNCCCC(F)(F)F)COCC1CC1 |
| InChI | InChI=1S/C11H20F3NO2/c12-11(13,14)4-1-5-15-6-10(16)8-17-7-9-2-3-9/h9-10,15-16H,1-8H2 |
| InChIKey | SGVLVZWSCDMLMQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|