C14H28F3NO2 — CID 115518703
1-(4-methylpentoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol (PubChem CID 115518703) has the molecular formula C14H28F3NO2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-(4-methylpentoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol.
| Compound Name | 1-(4-methylpentoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol |
|---|---|
| PubChem CID | 115518703 |
| Molecular Formula | C14H28F3NO2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 1-(4-methylpentoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol |
| SMILES | CC(C)CCCOCC(O)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO2/c1-12(2)6-5-9-20-11-13(19)10-18-8-4-3-7-14(15,16)17/h12-13,18-19H,3-11H2,1-2H3 |
| InChIKey | DIJIZKFWKSXIPV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|