C15H33NO3 — CID 106146723
4-[[2-hydroxy-3-(4-methylpentoxy)propyl]amino]-3,3-dimethylbutan-1-ol (PubChem CID 106146723) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-(4-methylpentoxy)propyl]amino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[[2-hydroxy-3-(4-methylpentoxy)propyl]amino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 106146723 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 4-[[2-hydroxy-3-(4-methylpentoxy)propyl]amino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)CCCOCC(O)CNCC(C)(C)CCO |
| InChI | InChI=1S/C15H33NO3/c1-13(2)6-5-9-19-11-14(18)10-16-12-15(3,4)7-8-17/h13-14,16-18H,5-12H2,1-4H3 |
| InChIKey | ADBXWBMAGGMCLZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|